C26H27N5OS — CID 980219
(2S)-2-[[5-(4-aminophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-benzhydrylpropanamide (PubChem CID 980219) has the molecular formula C26H27N5OS and a molecular weight of 457.60 g/mol. Its IUPAC name is (2S)-2-[[5-(4-aminophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-benzhydrylpropanamide.
| Compound Name | (2S)-2-[[5-(4-aminophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-benzhydrylpropanamide |
|---|---|
| PubChem CID | 980219 |
| Molecular Formula | C26H27N5OS |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | (2S)-2-[[5-(4-aminophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-benzhydrylpropanamide |
| SMILES | CCn1c(S[C@@H](C)C(=O)NC(c2ccccc2)c2ccccc2)nnc1-c1ccc(N)cc1 |
| InChI | InChI=1S/C26H27N5OS/c1-3-31-24(21-14-16-22(27)17-15-21)29-30-26(31)33-18(2)25(32)28-23(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-18,23H,3,27H2,1-2H3,(H,28,32)/t18-/m0/s1 |
| InChIKey | XSAJZPPJMRGVIJ-SFHVURJKSA-N |
| XLogP | 4.93 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|