C13H10ClNO2S — CID 98022837
2-(3-chlorophenyl)-4-cyclopropyl-1,3-thiazole-5-carboxylic acid (PubChem CID 98022837) has the molecular formula C13H10ClNO2S and a molecular weight of 279.75 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-4-cyclopropyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(3-chlorophenyl)-4-cyclopropyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 98022837 |
| Molecular Formula | C13H10ClNO2S |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 2-(3-chlorophenyl)-4-cyclopropyl-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1sc(-c2cccc(Cl)c2)nc1C1CC1 |
| InChI | InChI=1S/C13H10ClNO2S/c14-9-3-1-2-8(6-9)12-15-10(7-4-5-7)11(18-12)13(16)17/h1-3,6-7H,4-5H2,(H,16,17) |
| InChIKey | HAPSQYYQNZOFAQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |