C18H23N5O2S2 — CID 980311
N-[5-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]butanamide (PubChem CID 980311) has the molecular formula C18H23N5O2S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is N-[5-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]butanamide.
| Compound Name | N-[5-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 980311 |
| Molecular Formula | C18H23N5O2S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-[5-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]butanamide |
| SMILES | CCCC(=O)Nc1nnc(SCC(=O)N2CCN(c3ccccc3)CC2)s1 |
| InChI | InChI=1S/C18H23N5O2S2/c1-2-6-15(24)19-17-20-21-18(27-17)26-13-16(25)23-11-9-22(10-12-23)14-7-4-3-5-8-14/h3-5,7-8H,2,6,9-13H2,1H3,(H,19,20,24) |
| InChIKey | NATNYUKLMZZALW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|