C16H21ClN2 — CID 98034395
7-chloro-1,2-dimethyl-3-(piperidin-4-ylmethyl)indole (PubChem CID 98034395) has the molecular formula C16H21ClN2 and a molecular weight of 276.81 g/mol. Its IUPAC name is 7-chloro-1,2-dimethyl-3-(piperidin-4-ylmethyl)indole.
| Compound Name | 7-chloro-1,2-dimethyl-3-(piperidin-4-ylmethyl)indole |
|---|---|
| PubChem CID | 98034395 |
| Molecular Formula | C16H21ClN2 |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 7-chloro-1,2-dimethyl-3-(piperidin-4-ylmethyl)indole |
| SMILES | Cc1c(CC2CCNCC2)c2cccc(Cl)c2n1C |
| InChI | InChI=1S/C16H21ClN2/c1-11-14(10-12-6-8-18-9-7-12)13-4-3-5-15(17)16(13)19(11)2/h3-5,12,18H,6-10H2,1-2H3 |
| InChIKey | UWUZAIDILPQADZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|