C24H31O2P — CID 98040527
(1S,2S)-1-cyclohexyl-2-diphenylphosphoryl-4-methylpent-3-en-1-ol (PubChem CID 98040527) has the molecular formula C24H31O2P and a molecular weight of 382.48 g/mol. Its IUPAC name is (1S,2S)-1-cyclohexyl-2-diphenylphosphoryl-4-methylpent-3-en-1-ol.
| Compound Name | (1S,2S)-1-cyclohexyl-2-diphenylphosphoryl-4-methylpent-3-en-1-ol |
|---|---|
| PubChem CID | 98040527 |
| Molecular Formula | C24H31O2P |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (1S,2S)-1-cyclohexyl-2-diphenylphosphoryl-4-methylpent-3-en-1-ol |
| SMILES | CC(C)=C[C@@H]([C@@H](O)C1CCCCC1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H31O2P/c1-19(2)18-23(24(25)20-12-6-3-7-13-20)27(26,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h4-5,8-11,14-18,20,23-25H,3,6-7,12-13H2,1-2H3/t23-,24-/m0/s1 |
| InChIKey | FOACQDQSDXLHMH-ZEQRLZLVSA-N |
| XLogP | 5.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|