C6H7BrF6O — CID 98041577
1-bromo-4-(1,1-difluoroethoxy)-1,1,2,2-tetrafluorobutane (PubChem CID 98041577) has the molecular formula C6H7BrF6O and a molecular weight of 289.01 g/mol. Its IUPAC name is 1-bromo-4-(1,1-difluoroethoxy)-1,1,2,2-tetrafluorobutane.
| Compound Name | 1-bromo-4-(1,1-difluoroethoxy)-1,1,2,2-tetrafluorobutane |
|---|---|
| PubChem CID | 98041577 |
| Molecular Formula | C6H7BrF6O |
| Molecular Weight | 289.01 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | 1-bromo-4-(1,1-difluoroethoxy)-1,1,2,2-tetrafluorobutane |
| SMILES | CC(F)(F)OCCC(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C6H7BrF6O/c1-4(8,9)14-3-2-5(10,11)6(7,12)13/h2-3H2,1H3 |
| InChIKey | SMNREWUQSJVYOY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.01 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|