C9H9BrO4 — CID 98042923
(1R,2S,3R,6S,7R,9S)-2-bromo-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylic acid (PubChem CID 98042923) has the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. Its IUPAC name is (1R,2S,3R,6S,7R,9S)-2-bromo-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylic acid.
| Compound Name | (1R,2S,3R,6S,7R,9S)-2-bromo-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylic acid |
|---|---|
| PubChem CID | 98042923 |
| Molecular Formula | C9H9BrO4 |
| Molecular Weight | 261.07 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | (1R,2S,3R,6S,7R,9S)-2-bromo-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@H]2C[C@H]3[C@@H](OC(=O)[C@@H]31)[C@H]2Br |
| InChI | InChI=1S/C9H9BrO4/c10-6-2-1-3-5(4(2)8(11)12)9(13)14-7(3)6/h2-7H,1H2,(H,11,12)/t2-,3-,4-,5+,6+,7-/m1/s1 |
| InChIKey | YAUZWMLHLWHCLG-NYLBLOMBSA-N |
| XLogP | 0.64 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.07 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|