C12H11Cl3O — CID 98043608
(1R,2R,3R,4R,6R,7S,8R,9S,10R,12S)-4-(trichloromethyl)-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecane (PubChem CID 98043608) has the molecular formula C12H11Cl3O and a molecular weight of 277.58 g/mol. Its IUPAC name is (1R,2R,3R,4R,6R,7S,8R,9S,10R,12S)-4-(trichloromethyl)-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecane.
| Compound Name | (1R,2R,3R,4R,6R,7S,8R,9S,10R,12S)-4-(trichloromethyl)-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecane |
|---|---|
| PubChem CID | 98043608 |
| Molecular Formula | C12H11Cl3O |
| Molecular Weight | 277.58 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | (1R,2R,3R,4R,6R,7S,8R,9S,10R,12S)-4-(trichloromethyl)-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecane |
| SMILES | ClC(Cl)(Cl)[C@]12O[C@H]3[C@H]4[C@H]5[C@H]6C[C@H]([C@@H]5[C@H]41)[C@@H]2[C@@H]63 |
| InChI | InChI=1S/C12H11Cl3O/c13-12(14,15)11-8-3-1-2-4-5(3)9(11)7(4)10(16-11)6(2)8/h2-10H,1H2/t2-,3-,4+,5+,6-,7+,8-,9-,10-,11-/m1/s1 |
| InChIKey | XGTQIGLEBIUXBF-UFXKRVAZSA-N |
| XLogP | 2.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.58 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|