About (1R,5S)-3-bromobicyclo[3.2.1]octa-2,6-diene
(1R,5S)-3-bromobicyclo[3.2.1]octa-2,6-diene (PubChem CID 98043634) has the molecular formula C8H9Br
and a molecular weight of 185.06 g/mol. Its IUPAC name is (1R,5S)-3-bromobicyclo[3.2.1]octa-2,6-diene.
Molecular Properties
| Compound Name | (1R,5S)-3-bromobicyclo[3.2.1]octa-2,6-diene |
| PubChem CID | 98043634 |
| Molecular Formula | C8H9Br |
| Molecular Weight | 185.06 g/mol |
| Exact Mass | 183.99 |
| IUPAC Name | (1R,5S)-3-bromobicyclo[3.2.1]octa-2,6-diene |
| SMILES | BrC1=C[C@H]2C=C[C@H](C1)C2 |
| InChI | InChI=1S/C8H9Br/c9-8-4-6-1-2-7(3-6)5-8/h1-2,4,6-7H,3,5H2/t6-,7-/m0/s1 |
| InChIKey | XZYBMUGLFQCKOK-BQBZGAKWSA-N |
| XLogP | 2.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.06 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R,5S)-3-bromobicyclo[3.2.1]octa-2,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S)-3-bromobicyclo[3.2.1]octa-2,6-diene?
The IUPAC name of (1R,5S)-3-bromobicyclo[3.2.1]octa-2,6-diene (CID 98043634) is (1R,5S)-3-bromobicyclo[3.2.1]octa-2,6-diene.
What is the SMILES notation for (1R,5S)-3-bromobicyclo[3.2.1]octa-2,6-diene?
The canonical SMILES for (1R,5S)-3-bromobicyclo[3.2.1]octa-2,6-diene is BrC1=C[C@H]2C=C[C@H](C1)C2.
What is the InChIKey of (1R,5S)-3-bromobicyclo[3.2.1]octa-2,6-diene?
The InChIKey is XZYBMUGLFQCKOK-BQBZGAKWSA-N. The full InChI is InChI=1S/C8H9Br/c9-8-4-6-1-2-7(3-6)5-8/h1-2,4,6-7H,3,5H2/t6-,7-/m0/s1.
What are the key properties of (1R,5S)-3-bromobicyclo[3.2.1]octa-2,6-diene?
(1R,5S)-3-bromobicyclo[3.2.1]octa-2,6-diene has a molecular weight of 185.06 g/mol, XLogP of 2.86, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-3-bromobicyclo[3.2.1]octa-2,6-diene is sourced from PubChem (CID 98043634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).