About [(3S,5S)-3,5-dimethyl-1-adamantyl]methanol
[(3S,5S)-3,5-dimethyl-1-adamantyl]methanol (PubChem CID 98043737) has the molecular formula C13H22O
and a molecular weight of 194.32 g/mol. Its IUPAC name is [(3S,5S)-3,5-dimethyl-1-adamantyl]methanol.
Molecular Properties
| Compound Name | [(3S,5S)-3,5-dimethyl-1-adamantyl]methanol |
| PubChem CID | 98043737 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | [(3S,5S)-3,5-dimethyl-1-adamantyl]methanol |
| SMILES | C[C@@]12CC3CC(CO)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C13H22O/c1-11-3-10-4-12(2,6-11)8-13(5-10,7-11)9-14/h10,14H,3-9H2,1-2H3/t10?,11-,12-,13?/m0/s1 |
| InChIKey | RVWLWJAOIBEWAV-ZFQMDJOTSA-N |
| XLogP | 2.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(3S,5S)-3,5-dimethyl-1-adamantyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,5S)-3,5-dimethyl-1-adamantyl]methanol?
The IUPAC name of [(3S,5S)-3,5-dimethyl-1-adamantyl]methanol (CID 98043737) is [(3S,5S)-3,5-dimethyl-1-adamantyl]methanol.
What is the SMILES notation for [(3S,5S)-3,5-dimethyl-1-adamantyl]methanol?
The canonical SMILES for [(3S,5S)-3,5-dimethyl-1-adamantyl]methanol is C[C@@]12CC3CC(CO)(C1)C[C@@](C)(C3)C2.
What is the InChIKey of [(3S,5S)-3,5-dimethyl-1-adamantyl]methanol?
The InChIKey is RVWLWJAOIBEWAV-ZFQMDJOTSA-N. The full InChI is InChI=1S/C13H22O/c1-11-3-10-4-12(2,6-11)8-13(5-10,7-11)9-14/h10,14H,3-9H2,1-2H3/t10?,11-,12-,13?/m0/s1.
What are the key properties of [(3S,5S)-3,5-dimethyl-1-adamantyl]methanol?
[(3S,5S)-3,5-dimethyl-1-adamantyl]methanol has a molecular weight of 194.32 g/mol, XLogP of 2.98, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,5S)-3,5-dimethyl-1-adamantyl]methanol is sourced from PubChem (CID 98043737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).