About (4R)-3-methyl-4-prop-2-enyl-1,4-dihydropyrazol-5-one
(4R)-3-methyl-4-prop-2-enyl-1,4-dihydropyrazol-5-one (PubChem CID 98044338) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is (4R)-3-methyl-4-prop-2-enyl-1,4-dihydropyrazol-5-one.
Molecular Properties
| Compound Name | (4R)-3-methyl-4-prop-2-enyl-1,4-dihydropyrazol-5-one |
| PubChem CID | 98044338 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | (4R)-3-methyl-4-prop-2-enyl-1,4-dihydropyrazol-5-one |
| SMILES | C=CC[C@H]1C(=O)NN=C1C |
| InChI | InChI=1S/C7H10N2O/c1-3-4-6-5(2)8-9-7(6)10/h3,6H,1,4H2,2H3,(H,9,10)/t6-/m1/s1 |
| InChIKey | HSBODWONLBSICL-ZCFIWIBFSA-N |
| XLogP | 0.68 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-3-methyl-4-prop-2-enyl-1,4-dihydropyrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-3-methyl-4-prop-2-enyl-1,4-dihydropyrazol-5-one?
The IUPAC name of (4R)-3-methyl-4-prop-2-enyl-1,4-dihydropyrazol-5-one (CID 98044338) is (4R)-3-methyl-4-prop-2-enyl-1,4-dihydropyrazol-5-one.
What is the SMILES notation for (4R)-3-methyl-4-prop-2-enyl-1,4-dihydropyrazol-5-one?
The canonical SMILES for (4R)-3-methyl-4-prop-2-enyl-1,4-dihydropyrazol-5-one is C=CC[C@H]1C(=O)NN=C1C.
What is the InChIKey of (4R)-3-methyl-4-prop-2-enyl-1,4-dihydropyrazol-5-one?
The InChIKey is HSBODWONLBSICL-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H10N2O/c1-3-4-6-5(2)8-9-7(6)10/h3,6H,1,4H2,2H3,(H,9,10)/t6-/m1/s1.
What are the key properties of (4R)-3-methyl-4-prop-2-enyl-1,4-dihydropyrazol-5-one?
(4R)-3-methyl-4-prop-2-enyl-1,4-dihydropyrazol-5-one has a molecular weight of 138.17 g/mol, XLogP of 0.68, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-3-methyl-4-prop-2-enyl-1,4-dihydropyrazol-5-one is sourced from PubChem (CID 98044338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).