C13H10Cl4O4 — CID 98044432
(1R,2S,3R,5S,6S,7S,9S,10S)-2,3,5,6-tetrachloro-4,4-dimethoxypentacyclo[5.4.0.02,6.03,10.05,9]undecane-8,11-dione (PubChem CID 98044432) has the molecular formula C13H10Cl4O4 and a molecular weight of 372.03 g/mol. Its IUPAC name is (1R,2S,3R,5S,6S,7S,9S,10S)-2,3,5,6-tetrachloro-4,4-dimethoxypentacyclo[5.4.0.02,6.03,10.05,9]undecane-8,11-dione.
| Compound Name | (1R,2S,3R,5S,6S,7S,9S,10S)-2,3,5,6-tetrachloro-4,4-dimethoxypentacyclo[5.4.0.02,6.03,10.05,9]undecane-8,11-dione |
|---|---|
| PubChem CID | 98044432 |
| Molecular Formula | C13H10Cl4O4 |
| Molecular Weight | 372.03 g/mol |
| Exact Mass | 369.93 |
| IUPAC Name | (1R,2S,3R,5S,6S,7S,9S,10S)-2,3,5,6-tetrachloro-4,4-dimethoxypentacyclo[5.4.0.02,6.03,10.05,9]undecane-8,11-dione |
| SMILES | COC1(OC)[C@]2(Cl)[C@@H]3C(=O)[C@H]4[C@H]5C(=O)[C@H]3[C@@]1(Cl)[C@]5(Cl)[C@]42Cl |
| InChI | InChI=1S/C13H10Cl4O4/c1-20-13(21-2)11(16)5-6-8(19)4-3(7(5)18)9(11,14)10(4,15)12(6,13)17/h3-6H,1-2H3/t3-,4+,5-,6-,9+,10+,11+,12-/m0/s1 |
| InChIKey | IXQXXDRHGCNCJI-FPGBLYDUSA-N |
| XLogP | 1.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.03 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|