C17H16N4O — CID 98044613
(1R,2R,3S,5R,7R)-5-[(2-methylpropan-2-yl)oxy]tetracyclo[4.3.0.02,4.03,7]nonane-8,8,9,9-tetracarbonitrile (PubChem CID 98044613) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is (1R,2R,3S,5R,7R)-5-[(2-methylpropan-2-yl)oxy]tetracyclo[4.3.0.02,4.03,7]nonane-8,8,9,9-tetracarbonitrile.
| Compound Name | (1R,2R,3S,5R,7R)-5-[(2-methylpropan-2-yl)oxy]tetracyclo[4.3.0.02,4.03,7]nonane-8,8,9,9-tetracarbonitrile |
|---|---|
| PubChem CID | 98044613 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (1R,2R,3S,5R,7R)-5-[(2-methylpropan-2-yl)oxy]tetracyclo[4.3.0.02,4.03,7]nonane-8,8,9,9-tetracarbonitrile |
| SMILES | CC(C)(C)O[C@@H]1C2[C@@H]3[C@H]2[C@@H]2C1[C@@H]3C(C#N)(C#N)C2(C#N)C#N |
| InChI | InChI=1S/C17H16N4O/c1-15(2,3)22-14-10-8-9(10)13-11(14)12(8)16(4-18,5-19)17(13,6-20)7-21/h8-14H,1-3H3/t8-,9+,10?,11?,12-,13-,14-/m1/s1 |
| InChIKey | MJRZJIQDVUXQOS-NDFAENSLSA-N |
| XLogP | 1.99 |
| TPSA | 104.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|