C23H24N2S — CID 980448
(4S,8E)-4-(4-methylphenyl)-8-[(4-methylphenyl)methylidene]-1,3,4,5,6,7-hexahydroquinazoline-2-thione (PubChem CID 980448) has the molecular formula C23H24N2S and a molecular weight of 360.53 g/mol. Its IUPAC name is (4S,8E)-4-(4-methylphenyl)-8-[(4-methylphenyl)methylidene]-1,3,4,5,6,7-hexahydroquinazoline-2-thione.
| Compound Name | (4S,8E)-4-(4-methylphenyl)-8-[(4-methylphenyl)methylidene]-1,3,4,5,6,7-hexahydroquinazoline-2-thione |
|---|---|
| PubChem CID | 980448 |
| Molecular Formula | C23H24N2S |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (4S,8E)-4-(4-methylphenyl)-8-[(4-methylphenyl)methylidene]-1,3,4,5,6,7-hexahydroquinazoline-2-thione |
| SMILES | Cc1ccc(/C=C2\CCCC3=C2NC(=S)N[C@H]3c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H24N2S/c1-15-6-10-17(11-7-15)14-19-4-3-5-20-21(24-23(26)25-22(19)20)18-12-8-16(2)9-13-18/h6-14,21H,3-5H2,1-2H3,(H2,24,25,26)/b19-14+/t21-/m0/s1 |
| InChIKey | IJILAXXAWSYFLJ-CURYZJDOSA-N |
| XLogP | 5.34 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|