C24H18BrClFN3O2S — CID 98045369
(1S,9S,13R)-4-bromo-N-(4-chlorophenyl)-10-(4-fluorophenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide (PubChem CID 98045369) has the molecular formula C24H18BrClFN3O2S and a molecular weight of 546.85 g/mol. Its IUPAC name is (1S,9S,13R)-4-bromo-N-(4-chlorophenyl)-10-(4-fluorophenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide.
| Compound Name | (1S,9S,13R)-4-bromo-N-(4-chlorophenyl)-10-(4-fluorophenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
|---|---|
| PubChem CID | 98045369 |
| Molecular Formula | C24H18BrClFN3O2S |
| Molecular Weight | 546.85 g/mol |
| Exact Mass | 545.00 |
| IUPAC Name | (1S,9S,13R)-4-bromo-N-(4-chlorophenyl)-10-(4-fluorophenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
| SMILES | C[C@@]12Oc3ccc(Br)cc3[C@@H](NC(=S)N1c1ccc(F)cc1)[C@H]2C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H18BrClFN3O2S/c1-24-20(22(31)28-16-7-3-14(26)4-8-16)21(18-12-13(25)2-11-19(18)32-24)29-23(33)30(24)17-9-5-15(27)6-10-17/h2-12,20-21H,1H3,(H,28,31)(H,29,33)/t20-,21+,24-/m0/s1 |
| InChIKey | ACBFITCYRUOSIT-IMSXRSKXSA-N |
| XLogP | 6.04 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.85 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|