C28H27ClN2O6S — CID 98046377
[(1R,9R)-10-(4-chlorophenyl)-6-methoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-12-yl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 98046377) has the molecular formula C28H27ClN2O6S and a molecular weight of 555.05 g/mol. Its IUPAC name is [(1R,9R)-10-(4-chlorophenyl)-6-methoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-12-yl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [(1R,9R)-10-(4-chlorophenyl)-6-methoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-12-yl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 98046377 |
| Molecular Formula | C28H27ClN2O6S |
| Molecular Weight | 555.05 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | [(1R,9R)-10-(4-chlorophenyl)-6-methoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-12-yl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)N2C(=S)N(c3ccc(Cl)cc3)[C@@]3(C)C[C@@H]2c2cccc(OC)c2O3)cc(OC)c1OC |
| InChI | InChI=1S/C28H27ClN2O6S/c1-28-15-20(19-7-6-8-21(33-2)24(19)37-28)30(27(38)31(28)18-11-9-17(29)10-12-18)26(32)16-13-22(34-3)25(36-5)23(14-16)35-4/h6-14,20H,15H2,1-5H3/t20-,28-/m1/s1 |
| InChIKey | IYCOGXIWIGLOFZ-PIIWDFAUSA-N |
| XLogP | 5.86 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.05 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|