C24H17Cl3N2O3 — CID 98046481
(1R,9S)-10-(4-chlorophenyl)-12-(2,4-dichlorobenzoyl)-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one (PubChem CID 98046481) has the molecular formula C24H17Cl3N2O3 and a molecular weight of 487.77 g/mol. Its IUPAC name is (1R,9S)-10-(4-chlorophenyl)-12-(2,4-dichlorobenzoyl)-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one.
| Compound Name | (1R,9S)-10-(4-chlorophenyl)-12-(2,4-dichlorobenzoyl)-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one |
|---|---|
| PubChem CID | 98046481 |
| Molecular Formula | C24H17Cl3N2O3 |
| Molecular Weight | 487.77 g/mol |
| Exact Mass | 486.03 |
| IUPAC Name | (1R,9S)-10-(4-chlorophenyl)-12-(2,4-dichlorobenzoyl)-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one |
| SMILES | C[C@@]12C[C@H](c3ccccc3O1)N(C(=O)c1ccc(Cl)cc1Cl)C(=O)N2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H17Cl3N2O3/c1-24-13-20(18-4-2-3-5-21(18)32-24)28(22(30)17-11-8-15(26)12-19(17)27)23(31)29(24)16-9-6-14(25)7-10-16/h2-12,20H,13H2,1H3/t20-,24+/m1/s1 |
| InChIKey | GVYUFTIHUNNDRQ-YKSBVNFPSA-N |
| XLogP | 6.97 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.77 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |