C21H24NO4+ — CID 98047085
(8aS,12aR)-2,3,9,10-tetramethoxy-5,6,8a,12a-tetrahydroisoquinolino[2,1-b]isoquinolin-7-ium (PubChem CID 98047085) has the molecular formula C21H24NO4+ and a molecular weight of 354.43 g/mol. Its IUPAC name is (8aS,12aR)-2,3,9,10-tetramethoxy-5,6,8a,12a-tetrahydroisoquinolino[2,1-b]isoquinolin-7-ium.
| Compound Name | (8aS,12aR)-2,3,9,10-tetramethoxy-5,6,8a,12a-tetrahydroisoquinolino[2,1-b]isoquinolin-7-ium |
|---|---|
| PubChem CID | 98047085 |
| Molecular Formula | C21H24NO4+ |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (8aS,12aR)-2,3,9,10-tetramethoxy-5,6,8a,12a-tetrahydroisoquinolino[2,1-b]isoquinolin-7-ium |
| SMILES | COC1=C(OC)[C@@H]2C=[N+]3CCc4cc(OC)c(OC)cc4C3=C[C@H]2C=C1 |
| InChI | InChI=1S/C21H24NO4/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4/h5-6,9-13,16H,7-8H2,1-4H3/q+1/t13-,16-/m1/s1 |
| InChIKey | XXPJAVJXRGUFCB-CZUORRHYSA-N |
| XLogP | 3.00 |
| TPSA | 39.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|