C17H31NO4 — CID 98048176
(2S,3S)-1-dodecanoyl-3-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 98048176) has the molecular formula C17H31NO4 and a molecular weight of 313.44 g/mol. Its IUPAC name is (2S,3S)-1-dodecanoyl-3-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3S)-1-dodecanoyl-3-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 98048176 |
| Molecular Formula | C17H31NO4 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | (2S,3S)-1-dodecanoyl-3-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | CCCCCCCCCCCC(=O)N1CC[C@H](O)[C@H]1C(=O)O |
| InChI | InChI=1S/C17H31NO4/c1-2-3-4-5-6-7-8-9-10-11-15(20)18-13-12-14(19)16(18)17(21)22/h14,16,19H,2-13H2,1H3,(H,21,22)/t14-,16-/m0/s1 |
| InChIKey | ASHVYUAVTJHCGJ-HOCLYGCPSA-N |
| XLogP | 2.95 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|