C30H29NO9S — CID 98048220
[(1S,6S,7R,8R,8aR)-6,7-dibenzoyloxy-8-methylsulfonyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] benzoate (PubChem CID 98048220) has the molecular formula C30H29NO9S and a molecular weight of 579.63 g/mol. Its IUPAC name is [(1S,6S,7R,8R,8aR)-6,7-dibenzoyloxy-8-methylsulfonyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] benzoate.
| Compound Name | [(1S,6S,7R,8R,8aR)-6,7-dibenzoyloxy-8-methylsulfonyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] benzoate |
|---|---|
| PubChem CID | 98048220 |
| Molecular Formula | C30H29NO9S |
| Molecular Weight | 579.63 g/mol |
| Exact Mass | 579.16 |
| IUPAC Name | [(1S,6S,7R,8R,8aR)-6,7-dibenzoyloxy-8-methylsulfonyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] benzoate |
| SMILES | CS(=O)(=O)O[C@@H]1[C@H]2[C@@H](OC(=O)c3ccccc3)CCN2CC(OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H29NO9S/c1-41(35,36)40-27-25-23(37-28(32)20-11-5-2-6-12-20)17-18-31(25)19-24(38-29(33)21-13-7-3-8-14-21)26(27)39-30(34)22-15-9-4-10-16-22/h2-16,23-27H,17-19H2,1H3/t23-,24?,25+,26+,27+/m0/s1 |
| InChIKey | UTNWDWBEMQWFMW-WWIUPSBPSA-N |
| XLogP | 3.10 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.63 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|