C29H28N2O6 — CID 98048222
[(1S,6S,7S,8R,8aS)-8-amino-6,7-dibenzoyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] benzoate (PubChem CID 98048222) has the molecular formula C29H28N2O6 and a molecular weight of 500.55 g/mol. Its IUPAC name is [(1S,6S,7S,8R,8aS)-8-amino-6,7-dibenzoyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] benzoate.
| Compound Name | [(1S,6S,7S,8R,8aS)-8-amino-6,7-dibenzoyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] benzoate |
|---|---|
| PubChem CID | 98048222 |
| Molecular Formula | C29H28N2O6 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | [(1S,6S,7S,8R,8aS)-8-amino-6,7-dibenzoyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] benzoate |
| SMILES | N[C@@H]1[C@H]2[C@@H](OC(=O)c3ccccc3)CCN2CC(OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H28N2O6/c30-24-25-22(35-27(32)19-10-4-1-5-11-19)16-17-31(25)18-23(36-28(33)20-12-6-2-7-13-20)26(24)37-29(34)21-14-8-3-9-15-21/h1-15,22-26H,16-18,30H2/t22-,23?,24+,25+,26+/m0/s1 |
| InChIKey | JLRQRQNTDZFPHV-RHJYWKKISA-N |
| XLogP | 3.08 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|