C7H14N2 — CID 98048984
(1R,5R)-8-azabicyclo[3.2.1]octan-3-amine (PubChem CID 98048984) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is (1R,5R)-8-azabicyclo[3.2.1]octan-3-amine.
| Compound Name | (1R,5R)-8-azabicyclo[3.2.1]octan-3-amine |
|---|---|
| PubChem CID | 98048984 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | (1R,5R)-8-azabicyclo[3.2.1]octan-3-amine |
| SMILES | NC1C[C@H]2CC[C@H](C1)N2 |
| InChI | InChI=1S/C7H14N2/c8-5-3-6-1-2-7(4-5)9-6/h5-7,9H,1-4,8H2/t6-,7-/m1/s1 |
| InChIKey | ZERCTXGMBRAWQP-RNFRBKRXSA-N |
| XLogP | 0.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |