(3R)-oxolane-3-sulfonyl chloride

C4H7ClO3S — CID 98050551

IUPAC(3R)-oxolane-3-sulfonyl chloride
SMILESO=S(=O)(Cl)[C@@H]1CCOC1
InChIInChI=1S/C4H7ClO3S/c5-9(6,7)4-1-2-8-3-4/h4H,1-3H2/t4-/m1/s1
InChIKeyMVZIUOJNVVIOEY-SCSAIBSYSA-N
MW170.62 g/mol
LogP0.34
Rot. Bonds1

About (3R)-oxolane-3-sulfonyl chloride

(3R)-oxolane-3-sulfonyl chloride (PubChem CID 98050551) has the molecular formula C4H7ClO3S and a molecular weight of 170.62 g/mol. Its IUPAC name is (3R)-oxolane-3-sulfonyl chloride.

Molecular Properties

Compound Name(3R)-oxolane-3-sulfonyl chloride
PubChem CID98050551
Molecular FormulaC4H7ClO3S
Molecular Weight170.62 g/mol
Exact Mass169.98
IUPAC Name(3R)-oxolane-3-sulfonyl chloride
SMILESO=S(=O)(Cl)[C@@H]1CCOC1
InChIInChI=1S/C4H7ClO3S/c5-9(6,7)4-1-2-8-3-4/h4H,1-3H2/t4-/m1/s1
InChIKeyMVZIUOJNVVIOEY-SCSAIBSYSA-N
XLogP0.34
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.62
LogP ≤ 50.34
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze (3R)-oxolane-3-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R)-oxolane-3-sulfonyl chloride?
The IUPAC name of (3R)-oxolane-3-sulfonyl chloride (CID 98050551) is (3R)-oxolane-3-sulfonyl chloride.
What is the SMILES notation for (3R)-oxolane-3-sulfonyl chloride?
The canonical SMILES for (3R)-oxolane-3-sulfonyl chloride is O=S(=O)(Cl)[C@@H]1CCOC1.
What is the InChIKey of (3R)-oxolane-3-sulfonyl chloride?
The InChIKey is MVZIUOJNVVIOEY-SCSAIBSYSA-N. The full InChI is InChI=1S/C4H7ClO3S/c5-9(6,7)4-1-2-8-3-4/h4H,1-3H2/t4-/m1/s1.
What are the key properties of (3R)-oxolane-3-sulfonyl chloride?
(3R)-oxolane-3-sulfonyl chloride has a molecular weight of 170.62 g/mol, XLogP of 0.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-oxolane-3-sulfonyl chloride is sourced from PubChem (CID 98050551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).