C19H30O9 — CID 98051804
(6R)-5,5-dimethyl-3-oxo-6-[(3R)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]cyclohexene-1-carboxylic acid (PubChem CID 98051804) has the molecular formula C19H30O9 and a molecular weight of 402.44 g/mol. Its IUPAC name is (6R)-5,5-dimethyl-3-oxo-6-[(3R)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]cyclohexene-1-carboxylic acid.
| Compound Name | (6R)-5,5-dimethyl-3-oxo-6-[(3R)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]cyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 98051804 |
| Molecular Formula | C19H30O9 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (6R)-5,5-dimethyl-3-oxo-6-[(3R)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]cyclohexene-1-carboxylic acid |
| SMILES | C[C@H](CC[C@H]1C(C(=O)O)=CC(=O)CC1(C)C)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H30O9/c1-9(27-18-16(24)15(23)14(22)13(8-20)28-18)4-5-12-11(17(25)26)6-10(21)7-19(12,2)3/h6,9,12-16,18,20,22-24H,4-5,7-8H2,1-3H3,(H,25,26)/t9-,12+,13-,14-,15+,16-,18-/m1/s1 |
| InChIKey | HFYDDOQMBZTGBR-BJASGNCXSA-N |
| XLogP | -0.40 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |