C22H25NO4 — CID 98052185
[(5S,7S)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1-adamantyl] acetate (PubChem CID 98052185) has the molecular formula C22H25NO4 and a molecular weight of 367.44 g/mol. Its IUPAC name is [(5S,7S)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1-adamantyl] acetate.
| Compound Name | [(5S,7S)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1-adamantyl] acetate |
|---|---|
| PubChem CID | 98052185 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | [(5S,7S)-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1-adamantyl] acetate |
| SMILES | CC(=O)OC12C[C@H]3C[C@@H](CC(CCN4C(=O)c5ccccc5C4=O)(C3)C1)C2 |
| InChI | InChI=1S/C22H25NO4/c1-14(24)27-22-11-15-8-16(12-22)10-21(9-15,13-22)6-7-23-19(25)17-4-2-3-5-18(17)20(23)26/h2-5,15-16H,6-13H2,1H3/t15-,16-,21?,22?/m0/s1 |
| InChIKey | NQCUMZMSTLZBJM-TUKZGULFSA-N |
| XLogP | 3.57 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|