C25H18N6O3S4 — CID 98055355
(2S)-2-[[6-[(3-nitro-4-pyridin-2-ylsulfanylphenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 98055355) has the molecular formula C25H18N6O3S4 and a molecular weight of 578.73 g/mol. Its IUPAC name is (2S)-2-[[6-[(3-nitro-4-pyridin-2-ylsulfanylphenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | (2S)-2-[[6-[(3-nitro-4-pyridin-2-ylsulfanylphenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 98055355 |
| Molecular Formula | C25H18N6O3S4 |
| Molecular Weight | 578.73 g/mol |
| Exact Mass | 578.03 |
| IUPAC Name | (2S)-2-[[6-[(3-nitro-4-pyridin-2-ylsulfanylphenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | C[C@H](Sc1nc2ccc(/N=C/c3ccc(Sc4ccccn4)c([N+](=O)[O-])c3)cc2s1)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C25H18N6O3S4/c1-15(23(32)30-24-27-10-11-35-24)36-25-29-18-7-6-17(13-21(18)38-25)28-14-16-5-8-20(19(12-16)31(33)34)37-22-4-2-3-9-26-22/h2-15H,1H3,(H,27,30,32)/b28-14+/t15-/m0/s1 |
| InChIKey | LOPOMRAYXHZAAD-AYLNWMBDSA-N |
| XLogP | 7.08 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.73 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|