C15H9NO6 — CID 98055428
(4aS,9aR)-7-nitro-9,10-dioxo-4a,9a-dihydroanthracene-2-carboxylic acid (PubChem CID 98055428) has the molecular formula C15H9NO6 and a molecular weight of 299.24 g/mol. Its IUPAC name is (4aS,9aR)-7-nitro-9,10-dioxo-4a,9a-dihydroanthracene-2-carboxylic acid.
| Compound Name | (4aS,9aR)-7-nitro-9,10-dioxo-4a,9a-dihydroanthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 98055428 |
| Molecular Formula | C15H9NO6 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | (4aS,9aR)-7-nitro-9,10-dioxo-4a,9a-dihydroanthracene-2-carboxylic acid |
| SMILES | O=C(O)C1=C[C@H]2C(=O)c3cc([N+](=O)[O-])ccc3C(=O)[C@H]2C=C1 |
| InChI | InChI=1S/C15H9NO6/c17-13-9-3-1-7(15(19)20)5-11(9)14(18)12-6-8(16(21)22)2-4-10(12)13/h1-6,9,11H,(H,19,20)/t9-,11+/m0/s1 |
| InChIKey | HTXOTCFCZOABTO-GXSJLCMTSA-N |
| XLogP | 1.79 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|