C10H12N2O3 — CID 98056316
(3S,3aS,5R)-5-ethyl-3-methyl-3a,7-dihydro-3H-pyrrolo[2,3-b]pyridine-2,4,6-trione (PubChem CID 98056316) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is (3S,3aS,5R)-5-ethyl-3-methyl-3a,7-dihydro-3H-pyrrolo[2,3-b]pyridine-2,4,6-trione.
| Compound Name | (3S,3aS,5R)-5-ethyl-3-methyl-3a,7-dihydro-3H-pyrrolo[2,3-b]pyridine-2,4,6-trione |
|---|---|
| PubChem CID | 98056316 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | (3S,3aS,5R)-5-ethyl-3-methyl-3a,7-dihydro-3H-pyrrolo[2,3-b]pyridine-2,4,6-trione |
| SMILES | CC[C@H]1C(=O)NC2=NC(=O)[C@@H](C)[C@@H]2C1=O |
| InChI | InChI=1S/C10H12N2O3/c1-3-5-7(13)6-4(2)9(14)11-8(6)12-10(5)15/h4-6H,3H2,1-2H3,(H,11,12,14,15)/t4-,5+,6+/m0/s1 |
| InChIKey | DOOYPMDYFWMLAR-KVQBGUIXSA-N |
| XLogP | -0.10 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|