C34H48N2O3 — CID 98057797
4-decoxy-N-[4-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl]phenyl]benzamide (PubChem CID 98057797) has the molecular formula C34H48N2O3 and a molecular weight of 532.77 g/mol. Its IUPAC name is 4-decoxy-N-[4-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl]phenyl]benzamide.
| Compound Name | 4-decoxy-N-[4-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl]phenyl]benzamide |
|---|---|
| PubChem CID | 98057797 |
| Molecular Formula | C34H48N2O3 |
| Molecular Weight | 532.77 g/mol |
| Exact Mass | 532.37 |
| IUPAC Name | 4-decoxy-N-[4-[(1S,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl]phenyl]benzamide |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Nc2ccc(C(=O)N3C[C@]4(C)C[C@@H]3CC(C)(C)C4)cc2)cc1 |
| InChI | InChI=1S/C34H48N2O3/c1-5-6-7-8-9-10-11-12-21-39-30-19-15-26(16-20-30)31(37)35-28-17-13-27(14-18-28)32(38)36-25-34(4)23-29(36)22-33(2,3)24-34/h13-20,29H,5-12,21-25H2,1-4H3,(H,35,37)/t29-,34+/m0/s1 |
| InChIKey | QLJMAZMVTODTPJ-ZBWWXOROSA-N |
| XLogP | 8.50 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.77 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|