C26H31N3O3 — CID 98057938
(1'R,2S,2'S,4'S)-N-[2-(4-methoxyphenyl)ethyl]-1'-methyl-4-oxospiro[1,3-dihydroquinazoline-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide (PubChem CID 98057938) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is (1'R,2S,2'S,4'S)-N-[2-(4-methoxyphenyl)ethyl]-1'-methyl-4-oxospiro[1,3-dihydroquinazoline-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide.
| Compound Name | (1'R,2S,2'S,4'S)-N-[2-(4-methoxyphenyl)ethyl]-1'-methyl-4-oxospiro[1,3-dihydroquinazoline-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide |
|---|---|
| PubChem CID | 98057938 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | (1'R,2S,2'S,4'S)-N-[2-(4-methoxyphenyl)ethyl]-1'-methyl-4-oxospiro[1,3-dihydroquinazoline-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide |
| SMILES | COc1ccc(CCNC(=O)[C@H]2C[C@@H]3CC[C@]2(C)C[C@]32NC(=O)c3ccccc3N2)cc1 |
| InChI | InChI=1S/C26H31N3O3/c1-25-13-11-18(26(16-25)28-22-6-4-3-5-20(22)23(30)29-26)15-21(25)24(31)27-14-12-17-7-9-19(32-2)10-8-17/h3-10,18,21,28H,11-16H2,1-2H3,(H,27,31)(H,29,30)/t18-,21+,25+,26-/m0/s1 |
| InChIKey | JFVRXAQSODJUJU-JZSYQYRNSA-N |
| XLogP | 3.73 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |