C23H25N3O3 — CID 98058415
(1R,14R)-17-benzyl-7,8-dimethoxy-3,11,17-triazatetracyclo[12.2.1.03,12.05,10]heptadeca-5,7,9,11-tetraen-4-one (PubChem CID 98058415) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is (1R,14R)-17-benzyl-7,8-dimethoxy-3,11,17-triazatetracyclo[12.2.1.03,12.05,10]heptadeca-5,7,9,11-tetraen-4-one.
| Compound Name | (1R,14R)-17-benzyl-7,8-dimethoxy-3,11,17-triazatetracyclo[12.2.1.03,12.05,10]heptadeca-5,7,9,11-tetraen-4-one |
|---|---|
| PubChem CID | 98058415 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | (1R,14R)-17-benzyl-7,8-dimethoxy-3,11,17-triazatetracyclo[12.2.1.03,12.05,10]heptadeca-5,7,9,11-tetraen-4-one |
| SMILES | COc1cc2nc3n(c(=O)c2cc1OC)C[C@H]1CC[C@H](C3)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H25N3O3/c1-28-20-11-18-19(12-21(20)29-2)24-22-10-16-8-9-17(14-26(22)23(18)27)25(16)13-15-6-4-3-5-7-15/h3-7,11-12,16-17H,8-10,13-14H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | SHCYRICAJOZYKD-IAGOWNOFSA-N |
| XLogP | 3.00 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |