C10H15NO3 — CID 98059088
(1R,3R,4R)-1,7,7-trimethyl-3-nitrobicyclo[2.2.1]heptan-2-one (PubChem CID 98059088) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is (1R,3R,4R)-1,7,7-trimethyl-3-nitrobicyclo[2.2.1]heptan-2-one.
| Compound Name | (1R,3R,4R)-1,7,7-trimethyl-3-nitrobicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 98059088 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | (1R,3R,4R)-1,7,7-trimethyl-3-nitrobicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)C(=O)[C@@H]2[N+](=O)[O-] |
| InChI | InChI=1S/C10H15NO3/c1-9(2)6-4-5-10(9,3)8(12)7(6)11(13)14/h6-7H,4-5H2,1-3H3/t6-,7+,10-/m0/s1 |
| InChIKey | SYWPFFHYANKVSU-PJKMHFRUSA-N |
| XLogP | 1.66 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|