C28H27ClN4O3S — CID 98059910
2-[N-(benzenesulfonyl)-4-chloroanilino]-N-[(Z)-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]acetamide (PubChem CID 98059910) has the molecular formula C28H27ClN4O3S and a molecular weight of 535.07 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-chloroanilino]-N-[(Z)-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-chloroanilino]-N-[(Z)-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 98059910 |
| Molecular Formula | C28H27ClN4O3S |
| Molecular Weight | 535.07 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-chloroanilino]-N-[(Z)-[2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]acetamide |
| SMILES | Cc1ccccc1-n1c(C)cc(/C=N\NC(=O)CN(c2ccc(Cl)cc2)S(=O)(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C28H27ClN4O3S/c1-20-9-7-8-12-27(20)33-21(2)17-23(22(33)3)18-30-31-28(34)19-32(25-15-13-24(29)14-16-25)37(35,36)26-10-5-4-6-11-26/h4-18H,19H2,1-3H3,(H,31,34)/b30-18- |
| InChIKey | NZJUHZWBCREWLF-YKQZZPSBSA-N |
| XLogP | 5.40 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.07 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|