C23H24N6 — CID 98062359
(1S,12S)-7-(3-methylphenyl)-15-[(1-methylpyrazol-4-yl)methyl]-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene (PubChem CID 98062359) has the molecular formula C23H24N6 and a molecular weight of 384.49 g/mol. Its IUPAC name is (1S,12S)-7-(3-methylphenyl)-15-[(1-methylpyrazol-4-yl)methyl]-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene.
| Compound Name | (1S,12S)-7-(3-methylphenyl)-15-[(1-methylpyrazol-4-yl)methyl]-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene |
|---|---|
| PubChem CID | 98062359 |
| Molecular Formula | C23H24N6 |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | (1S,12S)-7-(3-methylphenyl)-15-[(1-methylpyrazol-4-yl)methyl]-4,8,9,15-tetrazatetracyclo[10.2.1.02,10.05,9]pentadeca-2(10),3,5,7-tetraene |
| SMILES | Cc1cccc(-c2cc3ncc4c(n3n2)C[C@@H]2CC[C@@H]4N2Cc2cnn(C)c2)c1 |
| InChI | InChI=1S/C23H24N6/c1-15-4-3-5-17(8-15)20-10-23-24-12-19-21-7-6-18(9-22(19)29(23)26-20)28(21)14-16-11-25-27(2)13-16/h3-5,8,10-13,18,21H,6-7,9,14H2,1-2H3/t18-,21-/m0/s1 |
| InChIKey | IZYRSJSXUHPEAL-RXVVDRJESA-N |
| XLogP | 3.70 |
| TPSA | 51.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |