C22H26N4O3 — CID 98062483
methyl 4-[(5-tert-butyl-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-11-yl)methyl]benzoate (PubChem CID 98062483) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is methyl 4-[(5-tert-butyl-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-11-yl)methyl]benzoate.
| Compound Name | methyl 4-[(5-tert-butyl-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-11-yl)methyl]benzoate |
|---|---|
| PubChem CID | 98062483 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | methyl 4-[(5-tert-butyl-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-11-yl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2CCc3nc4cc(C(C)(C)C)[nH]n4c(=O)c3C2)cc1 |
| InChI | InChI=1S/C22H26N4O3/c1-22(2,3)18-11-19-23-17-9-10-25(13-16(17)20(27)26(19)24-18)12-14-5-7-15(8-6-14)21(28)29-4/h5-8,11,24H,9-10,12-13H2,1-4H3 |
| InChIKey | PUPFOSBMSOBBLK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |