C24H15Cl2N5O2S4 — CID 98064512
N-[2-[(2,5-dichlorophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]-1-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-nitrophenyl]methanimine (PubChem CID 98064512) has the molecular formula C24H15Cl2N5O2S4 and a molecular weight of 604.59 g/mol. Its IUPAC name is N-[2-[(2,5-dichlorophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]-1-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-nitrophenyl]methanimine.
| Compound Name | N-[2-[(2,5-dichlorophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]-1-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-nitrophenyl]methanimine |
|---|---|
| PubChem CID | 98064512 |
| Molecular Formula | C24H15Cl2N5O2S4 |
| Molecular Weight | 604.59 g/mol |
| Exact Mass | 602.95 |
| IUPAC Name | N-[2-[(2,5-dichlorophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]-1-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-nitrophenyl]methanimine |
| SMILES | Cc1nnc(Sc2ccc(/C=N/c3ccc4nc(SCc5cc(Cl)ccc5Cl)sc4c3)cc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C24H15Cl2N5O2S4/c1-13-29-30-24(35-13)36-21-7-2-14(8-20(21)31(32)33)11-27-17-4-6-19-22(10-17)37-23(28-19)34-12-15-9-16(25)3-5-18(15)26/h2-11H,12H2,1H3/b27-11+ |
| InChIKey | HPPDABYOCASNGD-LUOAPIJWSA-N |
| XLogP | 8.87 |
| TPSA | 94.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.59 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|