C24H29N5O3 — CID 98065400
2-methyl-N-[[4-[5-(5-methylpyrazin-2-yl)-1,3,4-oxadiazol-2-yl]cyclohexyl]methyl]-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide (PubChem CID 98065400) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is 2-methyl-N-[[4-[5-(5-methylpyrazin-2-yl)-1,3,4-oxadiazol-2-yl]cyclohexyl]methyl]-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide.
| Compound Name | 2-methyl-N-[[4-[5-(5-methylpyrazin-2-yl)-1,3,4-oxadiazol-2-yl]cyclohexyl]methyl]-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 98065400 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 2-methyl-N-[[4-[5-(5-methylpyrazin-2-yl)-1,3,4-oxadiazol-2-yl]cyclohexyl]methyl]-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide |
| SMILES | Cc1cnc(-c2nnc(C3CCC(CNC(=O)c4c(C)oc5c4CCCC5)CC3)o2)cn1 |
| InChI | InChI=1S/C24H29N5O3/c1-14-11-26-19(13-25-14)24-29-28-23(32-24)17-9-7-16(8-10-17)12-27-22(30)21-15(2)31-20-6-4-3-5-18(20)21/h11,13,16-17H,3-10,12H2,1-2H3,(H,27,30) |
| InChIKey | XFACAKSOFLGRNH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |