C28H26F4N2O5 — CID 98066178
diethyl (4S,6S)-2-amino-4-(4-fluorophenyl)-5-oxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate (PubChem CID 98066178) has the molecular formula C28H26F4N2O5 and a molecular weight of 546.52 g/mol. Its IUPAC name is diethyl (4S,6S)-2-amino-4-(4-fluorophenyl)-5-oxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate.
| Compound Name | diethyl (4S,6S)-2-amino-4-(4-fluorophenyl)-5-oxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 98066178 |
| Molecular Formula | C28H26F4N2O5 |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | diethyl (4S,6S)-2-amino-4-(4-fluorophenyl)-5-oxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(N)N(c2cccc(C(F)(F)F)c2)C2=C(C(=O)[C@@H](C(=O)OCC)CC2)[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C28H26F4N2O5/c1-3-38-26(36)19-12-13-20-22(24(19)35)21(15-8-10-17(29)11-9-15)23(27(37)39-4-2)25(33)34(20)18-7-5-6-16(14-18)28(30,31)32/h5-11,14,19,21H,3-4,12-13,33H2,1-2H3/t19-,21-/m0/s1 |
| InChIKey | PRNNFMKYIKMMKJ-FPOVZHCZSA-N |
| XLogP | 4.98 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|