C13H14O3 — CID 98066262
(1R,2R,4S)-2-(furan-2-ylmethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 98066262) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (1R,2R,4S)-2-(furan-2-ylmethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2R,4S)-2-(furan-2-ylmethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 98066262 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (1R,2R,4S)-2-(furan-2-ylmethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)[C@@]1(Cc2ccco2)C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C13H14O3/c14-12(15)13(8-11-2-1-5-16-11)7-9-3-4-10(13)6-9/h1-5,9-10H,6-8H2,(H,14,15)/t9-,10-,13+/m0/s1 |
| InChIKey | UXWRUXNPZXHIIV-OUJBWJOFSA-N |
| XLogP | 2.49 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|