C43H44P2 — CID 98067314
bis(3,5-dimethylphenyl)-[(1S)-1-(2-dinaphthalen-1-ylphosphanylcyclopentyl)ethyl]phosphane (PubChem CID 98067314) has the molecular formula C43H44P2 and a molecular weight of 622.77 g/mol. Its IUPAC name is bis(3,5-dimethylphenyl)-[(1S)-1-(2-dinaphthalen-1-ylphosphanylcyclopentyl)ethyl]phosphane.
| Compound Name | bis(3,5-dimethylphenyl)-[(1S)-1-(2-dinaphthalen-1-ylphosphanylcyclopentyl)ethyl]phosphane |
|---|---|
| PubChem CID | 98067314 |
| Molecular Formula | C43H44P2 |
| Molecular Weight | 622.77 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | bis(3,5-dimethylphenyl)-[(1S)-1-(2-dinaphthalen-1-ylphosphanylcyclopentyl)ethyl]phosphane |
| SMILES | Cc1cc(C)cc(P(c2cc(C)cc(C)c2)[C@@H](C)C2CCCC2P(c2cccc3ccccc23)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C43H44P2/c1-29-23-30(2)26-36(25-29)44(37-27-31(3)24-32(4)28-37)33(5)38-19-12-22-41(38)45(42-20-10-15-34-13-6-8-17-39(34)42)43-21-11-16-35-14-7-9-18-40(35)43/h6-11,13-18,20-21,23-28,33,38,41H,12,19,22H2,1-5H3/t33-,38?,41?/m0/s1 |
| InChIKey | BVCVBGLXUGAVAF-XGISBARHSA-N |
| XLogP | 10.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.77 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|