C21H26N2O4 — CID 98069066
(1'R,2S,2'S,4'S)-1'-methyl-2'-(morpholine-4-carbonyl)spiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-4-one (PubChem CID 98069066) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is (1'R,2S,2'S,4'S)-1'-methyl-2'-(morpholine-4-carbonyl)spiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-4-one.
| Compound Name | (1'R,2S,2'S,4'S)-1'-methyl-2'-(morpholine-4-carbonyl)spiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-4-one |
|---|---|
| PubChem CID | 98069066 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (1'R,2S,2'S,4'S)-1'-methyl-2'-(morpholine-4-carbonyl)spiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-4-one |
| SMILES | C[C@]12CC[C@@H](C[C@@H]1C(=O)N1CCOCC1)[C@@]1(C2)NC(=O)c2ccccc2O1 |
| InChI | InChI=1S/C21H26N2O4/c1-20-7-6-14(12-16(20)19(25)23-8-10-26-11-9-23)21(13-20)22-18(24)15-4-2-3-5-17(15)27-21/h2-5,14,16H,6-13H2,1H3,(H,22,24)/t14-,16+,20+,21-/m0/s1 |
| InChIKey | OSQUKUJNMBEZBW-IWMXFIMRSA-N |
| XLogP | 2.19 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |