C22H28N2O3 — CID 98069078
(1'R,2S,2'S,4'S)-1'-methyl-2'-(piperidine-1-carbonyl)spiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-4-one (PubChem CID 98069078) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is (1'R,2S,2'S,4'S)-1'-methyl-2'-(piperidine-1-carbonyl)spiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-4-one.
| Compound Name | (1'R,2S,2'S,4'S)-1'-methyl-2'-(piperidine-1-carbonyl)spiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-4-one |
|---|---|
| PubChem CID | 98069078 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | (1'R,2S,2'S,4'S)-1'-methyl-2'-(piperidine-1-carbonyl)spiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-4-one |
| SMILES | C[C@]12CC[C@@H](C[C@@H]1C(=O)N1CCCCC1)[C@@]1(C2)NC(=O)c2ccccc2O1 |
| InChI | InChI=1S/C22H28N2O3/c1-21-10-9-15(13-17(21)20(26)24-11-5-2-6-12-24)22(14-21)23-19(25)16-7-3-4-8-18(16)27-22/h3-4,7-8,15,17H,2,5-6,9-14H2,1H3,(H,23,25)/t15-,17+,21+,22-/m0/s1 |
| InChIKey | YLDRNERIBBQYMH-NAYASGRBSA-N |
| XLogP | 3.34 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |