C21H26N2O4S — CID 98069681
(1'R,2S,2'S,4'S)-N-[(3S,4R)-4-hydroxythiolan-3-yl]-1'-methyl-4-oxospiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide (PubChem CID 98069681) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is (1'R,2S,2'S,4'S)-N-[(3S,4R)-4-hydroxythiolan-3-yl]-1'-methyl-4-oxospiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide.
| Compound Name | (1'R,2S,2'S,4'S)-N-[(3S,4R)-4-hydroxythiolan-3-yl]-1'-methyl-4-oxospiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide |
|---|---|
| PubChem CID | 98069681 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (1'R,2S,2'S,4'S)-N-[(3S,4R)-4-hydroxythiolan-3-yl]-1'-methyl-4-oxospiro[3H-1,3-benzoxazine-2,5'-bicyclo[2.2.2]octane]-2'-carboxamide |
| SMILES | C[C@]12CC[C@@H](C[C@@H]1C(=O)N[C@@H]1CSC[C@@H]1O)[C@@]1(C2)NC(=O)c2ccccc2O1 |
| InChI | InChI=1S/C21H26N2O4S/c1-20-7-6-12(8-14(20)19(26)22-15-9-28-10-16(15)24)21(11-20)23-18(25)13-4-2-3-5-17(13)27-21/h2-5,12,14-16,24H,6-11H2,1H3,(H,22,26)(H,23,25)/t12-,14+,15+,16-,20+,21-/m0/s1 |
| InChIKey | RLJIIEBSUWTVQN-BGAWUBSCSA-N |
| XLogP | 1.92 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |