C16H14BrNO4 — CID 98070919
(3aS,4R,7R,7aS)-2-(4-bromophenyl)-4-(hydroxymethyl)-7-methyl-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 98070919) has the molecular formula C16H14BrNO4 and a molecular weight of 364.20 g/mol. Its IUPAC name is (3aS,4R,7R,7aS)-2-(4-bromophenyl)-4-(hydroxymethyl)-7-methyl-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,4R,7R,7aS)-2-(4-bromophenyl)-4-(hydroxymethyl)-7-methyl-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 98070919 |
| Molecular Formula | C16H14BrNO4 |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | (3aS,4R,7R,7aS)-2-(4-bromophenyl)-4-(hydroxymethyl)-7-methyl-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | C[C@]12C=C[C@@](CO)(O1)[C@H]1C(=O)N(c3ccc(Br)cc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C16H14BrNO4/c1-15-6-7-16(8-19,22-15)12-11(15)13(20)18(14(12)21)10-4-2-9(17)3-5-10/h2-7,11-12,19H,8H2,1H3/t11-,12-,15-,16+/m1/s1 |
| InChIKey | KOSWIMVJIVWSQI-BHTHQVBYSA-N |
| XLogP | 1.64 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|