C17H17F2N3 — CID 98071048
(1R,9R)-12-[(2,5-difluorophenyl)methyl]-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 98071048) has the molecular formula C17H17F2N3 and a molecular weight of 301.34 g/mol. Its IUPAC name is (1R,9R)-12-[(2,5-difluorophenyl)methyl]-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | (1R,9R)-12-[(2,5-difluorophenyl)methyl]-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 98071048 |
| Molecular Formula | C17H17F2N3 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | (1R,9R)-12-[(2,5-difluorophenyl)methyl]-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | Cc1ncc2c(n1)C[C@H]1CC[C@H]2N1Cc1cc(F)ccc1F |
| InChI | InChI=1S/C17H17F2N3/c1-10-20-8-14-16(21-10)7-13-3-5-17(14)22(13)9-11-6-12(18)2-4-15(11)19/h2,4,6,8,13,17H,3,5,7,9H2,1H3/t13-,17-/m1/s1 |
| InChIKey | RAHLAZRGCVNELR-CXAGYDPISA-N |
| XLogP | 3.33 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |