About (1R,4S)-2-methylsulfonyl-2,5-diazabicyclo[2.2.1]heptane
(1R,4S)-2-methylsulfonyl-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 98071326) has the molecular formula C6H12N2O2S
and a molecular weight of 176.24 g/mol. Its IUPAC name is (1R,4S)-2-methylsulfonyl-2,5-diazabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | (1R,4S)-2-methylsulfonyl-2,5-diazabicyclo[2.2.1]heptane |
| PubChem CID | 98071326 |
| Molecular Formula | C6H12N2O2S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | (1R,4S)-2-methylsulfonyl-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | CS(=O)(=O)N1C[C@@H]2C[C@@H]1CN2 |
| InChI | InChI=1S/C6H12N2O2S/c1-11(9,10)8-4-5-2-6(8)3-7-5/h5-7H,2-4H2,1H3/t5-,6+/m0/s1 |
| InChIKey | KQFMRBHXRDGEAH-NTSWFWBYSA-N |
| XLogP | -1.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R,4S)-2-methylsulfonyl-2,5-diazabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,4S)-2-methylsulfonyl-2,5-diazabicyclo[2.2.1]heptane?
The IUPAC name of (1R,4S)-2-methylsulfonyl-2,5-diazabicyclo[2.2.1]heptane (CID 98071326) is (1R,4S)-2-methylsulfonyl-2,5-diazabicyclo[2.2.1]heptane.
What is the SMILES notation for (1R,4S)-2-methylsulfonyl-2,5-diazabicyclo[2.2.1]heptane?
The canonical SMILES for (1R,4S)-2-methylsulfonyl-2,5-diazabicyclo[2.2.1]heptane is CS(=O)(=O)N1C[C@@H]2C[C@@H]1CN2.
What is the InChIKey of (1R,4S)-2-methylsulfonyl-2,5-diazabicyclo[2.2.1]heptane?
The InChIKey is KQFMRBHXRDGEAH-NTSWFWBYSA-N. The full InChI is InChI=1S/C6H12N2O2S/c1-11(9,10)8-4-5-2-6(8)3-7-5/h5-7H,2-4H2,1H3/t5-,6+/m0/s1.
What are the key properties of (1R,4S)-2-methylsulfonyl-2,5-diazabicyclo[2.2.1]heptane?
(1R,4S)-2-methylsulfonyl-2,5-diazabicyclo[2.2.1]heptane has a molecular weight of 176.24 g/mol, XLogP of -1.01, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,4S)-2-methylsulfonyl-2,5-diazabicyclo[2.2.1]heptane is sourced from PubChem (CID 98071326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).