C17H16Cl2N4S2 — CID 98071805
(1S,5S,6R)-2-amino-6-(2,4-dichlorophenyl)-4,4-bis(ethylsulfanyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile (PubChem CID 98071805) has the molecular formula C17H16Cl2N4S2 and a molecular weight of 411.38 g/mol. Its IUPAC name is (1S,5S,6R)-2-amino-6-(2,4-dichlorophenyl)-4,4-bis(ethylsulfanyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile.
| Compound Name | (1S,5S,6R)-2-amino-6-(2,4-dichlorophenyl)-4,4-bis(ethylsulfanyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 98071805 |
| Molecular Formula | C17H16Cl2N4S2 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | (1S,5S,6R)-2-amino-6-(2,4-dichlorophenyl)-4,4-bis(ethylsulfanyl)-3-azabicyclo[3.1.0]hex-2-ene-1,5-dicarbonitrile |
| SMILES | CCSC1(SCC)N=C(N)[C@@]2(C#N)[C@@H](c3ccc(Cl)cc3Cl)[C@]12C#N |
| InChI | InChI=1S/C17H16Cl2N4S2/c1-3-24-17(25-4-2)16(9-21)13(15(16,8-20)14(22)23-17)11-6-5-10(18)7-12(11)19/h5-7,13H,3-4H2,1-2H3,(H2,22,23)/t13-,15-,16+/m1/s1 |
| InChIKey | OVSGKQRQAHUQGO-BMFZPTHFSA-N |
| XLogP | 4.64 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|