C20H24N2O2 — CID 98072127
(1R,9R)-12-[[4-(2-methoxyethoxy)phenyl]methyl]-6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene (PubChem CID 98072127) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is (1R,9R)-12-[[4-(2-methoxyethoxy)phenyl]methyl]-6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene.
| Compound Name | (1R,9R)-12-[[4-(2-methoxyethoxy)phenyl]methyl]-6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 98072127 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (1R,9R)-12-[[4-(2-methoxyethoxy)phenyl]methyl]-6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
| SMILES | COCCOc1ccc(CN2[C@@H]3CC[C@@H]2c2cccnc2C3)cc1 |
| InChI | InChI=1S/C20H24N2O2/c1-23-11-12-24-17-7-4-15(5-8-17)14-22-16-6-9-20(22)18-3-2-10-21-19(18)13-16/h2-5,7-8,10,16,20H,6,9,11-14H2,1H3/t16-,20-/m1/s1 |
| InChIKey | WNDZPERPKXUNAX-OXQOHEQNSA-N |
| XLogP | 3.37 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|