C16H20N2O — CID 98074658
(3aR)-2-(2,4-dimethylphenyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-3-one (PubChem CID 98074658) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is (3aR)-2-(2,4-dimethylphenyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-3-one.
| Compound Name | (3aR)-2-(2,4-dimethylphenyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-3-one |
|---|---|
| PubChem CID | 98074658 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | (3aR)-2-(2,4-dimethylphenyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-3-one |
| SMILES | Cc1ccc(N2N=C3CCCCC[C@H]3C2=O)c(C)c1 |
| InChI | InChI=1S/C16H20N2O/c1-11-8-9-15(12(2)10-11)18-16(19)13-6-4-3-5-7-14(13)17-18/h8-10,13H,3-7H2,1-2H3/t13-/m1/s1 |
| InChIKey | FNBKPTMOOVSQOW-CYBMUJFWSA-N |
| XLogP | 3.59 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |