C21H17N5O2 — CID 98074930
11-methyl-10-phenyl-5-(pyridine-4-carbonyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one (PubChem CID 98074930) has the molecular formula C21H17N5O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is 11-methyl-10-phenyl-5-(pyridine-4-carbonyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one.
| Compound Name | 11-methyl-10-phenyl-5-(pyridine-4-carbonyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one |
|---|---|
| PubChem CID | 98074930 |
| Molecular Formula | C21H17N5O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 11-methyl-10-phenyl-5-(pyridine-4-carbonyl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one |
| SMILES | Cc1[nH]n2c(=O)c3c(nc2c1-c1ccccc1)CN(C(=O)c1ccncc1)C3 |
| InChI | InChI=1S/C21H17N5O2/c1-13-18(14-5-3-2-4-6-14)19-23-17-12-25(11-16(17)21(28)26(19)24-13)20(27)15-7-9-22-10-8-15/h2-10,24H,11-12H2,1H3 |
| InChIKey | PFAKUQYKNPWCSZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |